Zu "375835-43-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Necrostatin-34
Artikelnummer: TGM-T9095-100mg
Description: Necrostatin-34 (2-{[3-cyano-4-(4-methylphenyl)-6-oxo-1,4) is a RIPK1 kinase inhibitor, stabilizing RIPK1 kinase in an inactive conformation by occupying a distinct binding pocket in the kinase domain. Target: RIP kinase. Smiles: Cc1ccc(cc1)C1CC(=O)NC(SCC(=O)Nc2nccs2)=C1C#N. References: Huyan Meng, et...
| Schlagworte: | 2-{[3-cyano-4-(4-methylphenyl)-6-oxo-1,4 |
| Anwendung: | RIPK1 inhibitor |
| CAS | 375835-43-1 |
| MW: | 384.48 D |
ab 78,00 €
Necrostatin-34
Artikelnummer: Cay37735-1
Necrostatin-34 is an inhibitor of receptor-interacting serine/threonine kinase 1 (RIPK1, IC50 = 5.5 µM). It inhibits TNF-alpha-induced necroptosis in Jurkat cells lacking Fas-associated death domain protein (FADD) and L-929 cells (IC50s = 6.67 and 1.35 µM, respectively). Necrostatin-34 (10 µM) inhibits necroptosis...
| Schlagworte: | Nec-34, 2-[[3-cyano-1,4,5,6-tetrahydro-4-(4-methylphenyl)-6-oxo-2-pyridinyl]thio]-N-2-thiazolyl-acetamide |
| Anwendung: | RIPK1 inhibitor |
| CAS | 375835-43-1 |
| MW: | 384.5 D |
ab 82,00 €
