Zu "37517-28-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Amikacin
Artikelnummer: TGM-T1013-100mg
Description: Amikacin (Amikacina) is a broad-spectrum antibiotic derived from kanamycin. Target: ribosome. Smiles: NCC[C@H](O)C(=O)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O. References: Tolmasky ME. Front Biosci. 2000 Jan 1,5:D20-9.
| Schlagworte: | Amikacinum, Amikacina, Amikacine |
| CAS | 37517-28-5 |
| MW: | 585.6 D |
ab 31,00 €
Amikacin
Artikelnummer: Cay15405-1
Amikacin is an aminoglycoside antibiotic derived from kanamycin A. Like other aminoglycosides, amikacin binds to bacterial ribosomes and disrupts translation. However, the specific binding sites differ between different aminoglycoside antibiotics, as do the mechanisms of resistance. Amikacin is effective against...
| Schlagworte: | Antibiotic BB-K 8, BAY 41-6551, BB-K 8, Lukadin, Potentox,... |
| Anwendung: | Aminoglycoside antibiotic |
| CAS | 37517-28-5 |
| MW: | 585.6 D |
ab 66,00 €
