Zu "374620-70-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NBI-31772
Artikelnummer: TGM-T8906-100mg
Description: NBI-31772 (NBI 31772) is the potent inhibitor of insulin-like growth factor-1 binding protein (IGFBP, Ki = 47 nM). NBI-31772 can be used in research on IGF-responsive diseases. Target: IGF-1R. Smiles: OC(=O)c1cc2cc(O)c(O)cc2c(n1)C(=O)c1ccc(O)c(O)c1. References: Rinker TE, et al. Microparticle-mediated...
| Schlagworte: | NBI31772, NBI 31772 |
| Anwendung: | IGFBP ligand |
| CAS | 374620-70-9 |
| MW: | 341.27 D |
ab 51,00 €
NBI 31772
Artikelnummer: Cay19122-1
NBI 31772 is a nonpeptide ligand that releases insulin-like growth factor-1 (IGF-1) from its binding protein (IGFBP, Kis = 1-24 nM for the six human subtypes of IGFBP). As the released IGF-1 is biologically active, NBI 31772 is used to assess the role of IGF-1 in cells and animals, including in neuron survival,...
| Schlagworte: | 1-(3,4-dihydroxybenzoyl)-6,7-dihydroxy-3-isoquinolinecarboxylic acid |
| Anwendung: | IGFBP ligand |
| CAS | 374620-70-9 |
| MW: | 341.3 D |
ab 43,00 €
