Zu "373-49-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Palmitoleic Acid
Artikelnummer: Cay10009871-100
Palmitoleic acid is an omega-7 monounsaturated fatty acid that has been found in macadamia and sea buckthorn oils. It increases basal and insulin-stimulated glucose uptake and glucose transporter 4 (Glut4) protein levels in 3T3-L1 adipocytes when used at a concentration of 200 µM. Ex vivo, palmitoleic acid (300...
| Schlagworte: | (9Z)-Hexadecenoic Acid, cis-Palmitoleic Acid, C16:1 n-7, C16:1(9Z), (9Z)-hexadecenoic acid |
| Anwendung: | Bioactive lipid assays |
| CAS | 373-49-9 |
| MW: | 254.4 D |
ab 35,00 €
Palmitoleic acid
Artikelnummer: TGM-T4872-1mL
Description: Palmitoleic acid ((Z)-Hexadec-9-enoic acid) is found to be associated with isovaleric acidemia, which is an inborn error of metabolism. Target: Endogenous Metabolite. Smiles: CCCCCC\C=C/CCCCCCCC(O)=O. References: Ogunleye A, et al. Fatty acid composition of breast milk from Nigerian and Japanese women....
| Schlagworte: | (Z)-9-hexadecenoic acid, (Z)-Hexadec-9-enoic acid |
| CAS | 373-49-9 |
| MW: | 254.41 D |
ab 33,00 €
