Zu "36945-98-9" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ICILIN
Artikelnummer: TGM-T1814-5mg
Description: ICILIN (AG-3-5) is a synthetic TRPM8 ion channel super-agonist. Target: TRP/TRPV Channel. Smiles: Oc1ccccc1N1CC=C(NC1=O)c1cccc(c1)[N+]([O-])=O. References: Lee S, et al. Biochem Biophys Res Commun. 2013 Nov 29,441(4):1005-10.
| Schlagworte: | AG-3-5 |
| Anwendung: | CMR1 super agonist, TRPM8 super agonist |
| CAS | 36945-98-9 |
| MW: | 311.29 D |
ab 31,00 €
Icilin
Artikelnummer: Cay10137-50
Nociceptive sensory peripheral neurons often express both heat sensitive (VR1) and cold-sensitive (CMR1 (rat), TRPM8 (human)) receptors that are part of the transient receptor potential (TRP) superfamily. Icilin is a synthetic CMR1/TRPM8 super agonist that is 2.5-fold more efficacious and nearly 200-fold more potent...
| Schlagworte: | AG 3-5, 3,6-dihydro-1-(2-hydroxyphenyl)-4-(3-nitrophenyl)-2(1H)-pyrimidinone |
| Anwendung: | CMR1 super agonist, TRPM8 super agonist |
| CAS | 36945-98-9 |
| MW: | 311.3 D |
ab 69,00 €
Icilin
Artikelnummer: LKT-I0933.10
TRPM8 activator, TRPV3 blocker.
| Schlagworte: | AG 3-5 |
| Anwendung: | TRPM8 activator, TRPV3 blocker |
| CAS | 36945-98-9 |
| MW: | 311.3 D |
ab 117,00 €
