Zu "3565-26-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NSC 3852
Artikelnummer: TGM-T7691-100mg
Description: NSC 3852 is a potent inhibitor of histone deacetylase. Target: HDAC. Smiles: OC1=C2N=CC=CC2=C(C=C1)N=O. References: Jeannine S. Strobl, Christopher W. Seibert, Yunbo Li, Rana Nagarkatti, Sheila M. Mitchell, Alexa C. Rosypal, Dharmendar Rathore, and David S. Lindsay. Inhibition of Toxoplasma gondii and...
| Anwendung: | HDAC inhibitor |
| CAS | 3565-26-2 |
| MW: | 174.16 D |
ab 52,00 €
5-Nitroso-8-quinolinol
Artikelnummer: Cay13856-10
5-Nitroso-8-quinolinol is a chemically unique HDAC inhibitor that harbors a different Zn2+ chelation motif compared to SAHA. As an antitumor agent, 10 µM 5-nitroso-8-quinolinol can induce oxidative stress contributing to apoptosis and differentiation in MCF-7 breast cancer cells. Additionally, 5-nitroso-8-quinolinol...
| Schlagworte: | Hydron III, NSC 3852, 5-nitroso-8-quinolinol |
| Anwendung: | HDAC inhibitor |
| CAS | 3565-26-2 |
| MW: | 174.2 D |
ab 52,00 €
