Zu "356057-34-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Darapladib
Artikelnummer: TGM-T6109-100mg
Description: Darapladib (SB-480848)(IC50=0.25 nM) is a substituted pyrimidone with inhibitory activity towards lipoprotein-associated phospholipase-A2 (Lp-PLA2). Target: Phospholipase. Smiles: C(C(N(CC1=CC=C(C=C1)C2=CC=C(C(F)(F)F)C=C2)CCN(CC)CC)=O)N3C4=C(C(=O)N=C3SCC5=CC=C(F)C=C5)CCC4. References: Blackie JA, et al....
| Schlagworte: | SB-480848 |
| Anwendung: | Targets platelet-activating factor acetylhydrolase [EC:3.1.1.47] (PLA2G7, PAFAH) |
| CAS | 356057-34-6 |
| MW: | 666.77 D |
ab 45,00 €
Darapladib
Artikelnummer: Cay16429-5
Lipoprotein-associated phospholipase A2 (Lp-PLA2), also known as platelet activating factor acetylhydrolase (PAF-AH) or phospholipase A2 group 7 (PLA2G7), hydrolyzes glycerophospholipids to produce lyso-PAF/lyso-phosphatidylcholine and short and/or oxidized fatty acids, many of which have pro-inflammatory or...
| Schlagworte: | SB-480848,... |
| Anwendung: | PLA2G7 inhibitor |
| CAS | 356057-34-6 |
| MW: | 666.8 D |
ab 67,00 €
