Zu "355025-24-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ki16425
Artikelnummer: TGM-T6108-100mg
Description: Ki16425 (Debio 0719) is a competitive, potent, and reversible antagonist to LPA1, LPA2, and LPA3, with Ki values of 0.34 µM, 6.5 µM, and 0.93 µM, respectively. Target: LPA Receptor, LPL Receptor. Smiles: CC(OC(=O)Nc1c(C)noc1-c1ccc(CSCCC(O)=O)cc1)c1ccccc1Cl. References: Ohta H, et al, Mol Pharmacol,...
| Schlagworte: | Debio 0719 |
| Anwendung: | LPA receptor antagonist |
| CAS | 355025-24-0 |
| MW: | 474.96 D |
ab 37,00 €
Ki16425
Artikelnummer: Cay10012659-10
Lysophosphatidic acid (LPA) is a bioactive lipid mediator that signals through five distinct G protein-coupled receptors (LPA1-5). Ki16425 is a LPA receptor antagonist with selectivity for LPA1 and LPA3. It exhibits Ki values of 0.34, 6.5, and 0.93 µM for the human LPA1, LPA2, and LPA3 receptors, respectively, as...
| Schlagworte: | 3-[[[4-[4-[[[1-(2-chlorophenyl)ethoxy]carbonyl]amino]-3-methyl-5-isoxazoly]phenyl]methyl]thio]-propanoic acid |
| Anwendung: | LPA receptor antagonist |
| CAS | 355025-24-0 |
| MW: | 475 D |
ab 52,00 €
