Zu "354812-16-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AA43279
Artikelnummer: TGM-T71854-10mg
Description: AA43279 is a novel selective Nav1.1 activator, increasing the firing activity of parvalbumin-expressing, fast-spiking GABAergic interneurons and increasing the spontaneous inhibitory post-synaptic currents (sIPSCs) recorded from pyramidal neurons. Target: Others. Smiles: COc1ccc(cc1)-c1cc(N)c(s1)C(N)=O
| Anwendung: | Nav1.1 activator |
| CAS | 354812-16-1 |
| MW: | 248.3 D |
ab 120,00 €
AA43279
Artikelnummer: Cay40428-10
AA43279 is an activator of voltage-gated sodium channel 1.1 (Nav1.1, EC50 = 9.5 µM in a patch-clamp assay using HEK293 cells expressing the human channel). It is selective for Nav1.1 over Nav1.4 and Nav1.7 at 30 µM but also activates Nav1.2, Nav1.5, and Nav1.6 (EC50s = 22.8, 14.4, and 11.6 µM, respectively). AA43279...
| Schlagworte: | 3-amino-5-(4-methoxyphenyl)-2-thiophenecarboxamide |
| Anwendung: | Nav1.1 activator |
| CAS | 354812-16-1 |
| MW: | 248.3 D |
ab 66,00 €
