Zu "3520-42-1" wurden 3 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Sulforhodamine B sodium salt
Sulforhodamine B sodium salt

Artikelnummer: TGM-T19063-1g

Description: Sulforhodamine B sodium salt (Acid Red 52) is a fluorescent dye. It can be used from laser-induced fluorescence to the quantification of cellular proteins of cultured cells. Target: Others. Smiles: O=S(C1=CC=C(C2=C3C=CC(N(CC)CC)=CC3=[O+]C4=C2C=CC(N(CC)CC)=C4)C(S(=O)([O-])=O)=C1)(O[Na])=O. References:...
Schlagworte: Kiton Red 620, Acid Red 52
CAS 3520-42-1
MW: 580.65 D
30,00 €
Bewerten
Sulforhodamine B *Fluorescence reference standard*
Sulforhodamine B *Fluorescence reference standard*

Artikelnummer: ABD-72

Sulforhodamine B, also known as Kiton Red, is primarily used as a polar tracer. It does not exhibit pH-dependent absorption or fluorescence over the range of 3 to 10.
Anwendung: Labeling
CAS 3520-42-1
110,00 €
Bewerten
Sulforhodamine B (sodium salt) (technical grade)
Sulforhodamine B (sodium salt) (technical grade)

Artikelnummer: Cay31539-10

Sulforhodamine B is an aminoxanthene dye. It binds basic amino acid residues under mild acidic conditions, which can be quantified by colorimetric detection at 510 nM, and is commonly used for cell density quantification in cytotoxicity screening.Formal Name: 3,6-bis(diethylamino)-9-(2,4-disulfophenyl)-xanthylium,...
Schlagworte: Acid Red XB, 3,6-bis(diethylamino)-9-(2,4-disulfophenyl)-xanthylium, inner salt, monosodium salt
Anwendung: Aminoxanthene dye, cell density quantification, cytotoxicity screening
CAS 3520-42-1
MW: 580.7 D
ab 81,00 €
Bewerten