Zu "3512-87-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Akuammine
Artikelnummer: TGM-T25018-10mg
Description: Akuammine is an antimalarial indolemonoterpene alkaloid from Picralima nitida seeds. Target: Others. Smiles: C(OC)(=O)[C@@]12[C@]34[C@]([C@]5(N(CC3)C\C(=C\C)\[C@@]1(C5)[H])[H])(N(C)C=6C4=CC(O)=CC6)OC2. References: Moreno J, Picazo E, Morrill LA, Smith JM, Garg NK. Enantioselective Total Syntheses of...
| Anwendung: | Indole alkaloid, analgesic agent |
| CAS | 3512-87-6 |
| MW: | 382.45 D |
ab 289,00 €
Akuammine
Artikelnummer: Cay35149-1
Akuammine is an indole alkaloid that has been found in Picralima nitida and has analgesic activity. It selectively binds to the µ- and kappa-opioid receptors over the delta-opioid receptor (Kis = 0.3, 1.68, and 10.4 µM for the human receptors, respectively). Akuammine inhibits forskolin-induced cAMP production in...
| Schlagworte: | (-)-Akuammine, Vincamajoridine,... |
| Anwendung: | Indole alkaloid, analgesic agent |
| CAS | 3512-87-6 |
| MW: | 382.5 D |
ab 159,00 €
