Zu "34834-67-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
trans-3'-Hydroxycotinine
Artikelnummer: Cay16100-5
trans-3'-Hydroxycotinine (3HC) is a product of CYP2A6 metabolism of the primary nicotine metabolite, cotinine (Cay-15314). Cotinine has a longer metabolic half-life compared to 3HC (16 hours vs. 5 hours). The ratio of 3HC to cotinine, termed the nicotine metabolite ratio, correlates with nicotine clearance from the...
| Schlagworte: | 3HC, 3R-hydroxy-1-methyl-5S-(3-pyridinyl)-2-pyrrolidinone |
| Anwendung: | Nicotine metabolite, CYP2A6 activity biomarker |
| CAS | 34834-67-8 |
| MW: | 192.2 D |
ab 78,00 €
Hydroxycotinine
Artikelnummer: TGM-T19361-10mg
Description: Hydroxycotinine, the main nicotine metabolite, is detected in smokers' urine. Target: Others. Smiles: CN1[C@@H](C[C@@H](O)C1=O)c1cccnc1
| Anwendung: | Nicotine metabolite, CYP2A6 activity biomarker |
| CAS | 34834-67-8 |
| MW: | 192.218 D |
ab 481,00 €
