Zu "345630-40-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SF1670
Artikelnummer: TGM-T6667-100mg
Description: SF1670 (PTPase CD45 Inhibitor) is a specific PTEN inhibitor with IC50 of 2 µM. Target: Autophagy, Phosphatase, PTEN. Smiles: CC(C)(C)C(=O)Nc1ccc-2c(c1)C(=O)C(=O)c1ccccc-21. References: Garlich JR, et al. PCT/US2005/011626.
| Schlagworte: | PTPase CD45 Inhibitor, PTP CD45 Inhibitor |
| Anwendung: | PTEN inhibitor |
| CAS | 345630-40-2 |
| MW: | 307.34 D |
ab 37,00 €
SF1670
Artikelnummer: Cay15368-1
Phosphatase and tensin homology on chromosome 10 (PTEN) functions as a key regulatory enzyme in many signal transduction pathways by dephosphorylating proteins and lipids including Akt and phosphatidylinositol 3,4,5-trisphosphate (PIP3). SF1670 specifically binds to the active site of PTEN inhibiting its activity...
| Schlagworte: | N-(9,10-dihydro-9,10-dioxo-2-phenanthrenyl)-2,2-dimethyl-propanamide |
| Anwendung: | PTEN inhibitor |
| CAS | 345630-40-2 |
| MW: | 307.4 D |
ab 84,00 €
