Zu "343787-29-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CP-673451
Artikelnummer: TGM-T6091-100mg
Description: CP-673451 is a specific inhibitor of PDGFRalpha/beta (IC50: 10/1 nM) with antiangiogenic and antitumor activity and the selectivity is higher 450-fold than other angiogenic receptors. Target: PDGFR, VEGFR, c-Kit. Smiles: COCCOc1ccc2n(cnc2c1)-c1ccc2cccc(N3CCC(N)CC3)c2n1. References: Roberts WG, et al....
| Anwendung: | PDGFRbeta inhibitor |
| CAS | 343787-29-1 |
| MW: | 417.5 D |
ab 45,00 €
CP 673,451
Artikelnummer: Cay19170-1
CP-673,451 is a selective inhibitor of the platelet-derived growth factor receptor beta (PDGFRbeta) kinase with an IC50 value of 1 nM. It also inhibits the PDGFRalpha kinase (IC50 = 10 nM), but exhibits greater than 450-fold selectivity over other angiogenic receptors such as VEGFR 2, TIE-2, and FGR2. In several in...
| Schlagworte: | 1-[2-[5-(2-methoxyethoxy)-1H-benzimidazol-1-yl]-8-quinolinyl]-4-piperidinamine |
| Anwendung: | PDGFRbeta inhibitor |
| CAS | 343787-29-1 |
| MW: | 417.5 D |
ab 61,00 €
