Zu "331-39-5" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Caffeic Acid
Artikelnummer: TGM-T2807-100mg
Description: Caffeic Acid is an orally bioavailable, hydroxycinnamic acid derivative and polyphenol, with potential anti-oxidant, anti-inflammatory, and antineoplastic activities. Target: TRP/TRPV Channel, Lipoxygenase, Endogenous Metabolite. Smiles: C(=CC(O)=O)C1=CC(O)=C(O)C=C1. References: Pradhananga S, Shim...
| Anwendung: | Tyrosine kinase inhibitor |
| CAS | 331-39-5 |
| MW: | 180.16 D |
ab 34,00 €
Caffeic Acid
Artikelnummer: Cay70602-5
Caffeic acid is an inhibitor of 5-LO with an IC50 value of 3.7-72 µM and 12-LO with an IC50 value of 5.1-30 µM.Formal Name: 3-(3,4-dihydroxyphenyl)-2-propenoic acid. CAS Number: 331-39-5. Synonyms: 3,4-Dihydroxycinnamic Acid. Molecular Formula: C9H8O4. Formula Weight: 180.2. Purity: >97%. Formulation: (Request...
| Schlagworte: | 3,4-Dihydroxycinnamic Acid, 3-(3,4-dihydroxyphenyl)-2-propenoic acid |
| Anwendung: | 5-LO inhibitor |
| CAS | 331-39-5 |
| MW: | 180.2 D |
ab 44,00 €
Caffeic acid
Artikelnummer: CDX-C0024-G005
Caffeic Acid is an endogenous phenolic phytochemical compound that inhibits a number of lipoxygenases such as 5-LO (5-lipoxygenase), in a non-competitive manner, and 12-LO (12-lipoxygenase) inhibiting leukotriene synthesis involved in immunoregulation, inflammation and allergy. Caffeic acid has antioxidant,...
| Schlagworte: | 3,4-Dihydroxybenzeneacrylic acid, 3,4-Dihydroxycinnamic acid, 3-(3,4-Dihydroxyphenyl)-2-propenoic acid |
| Anwendung: | Phenolic phytochemical compound |
| CAS | 331-39-5 |
| MW: | 180.16 D |
ab 31,00 €
Caffeic acid
Artikelnummer: LKT-C0121.25
Inhibitor of ornithine decarboxylase and protein tyrosine kinase.
| Schlagworte: | 3,4-Dihydroxycinnamic acid |
| Anwendung: | Tyrosine kinase inhibitor |
| CAS | 331-39-5 |
| MW: | 180,16 D |
ab 86,00 €
