Zu "3301-79-9" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
6-FAM
Artikelnummer: TGM-T18902-100mg
Description: 6-Carboxyfluorescein (6-FAM) contains a carboxylic acid functional group, facilitating reactions with primary amines through carbodiimide activation. Target: Others. Smiles: OC(=O)c1ccc2C(=O)OC3(c2c1)c1ccc(O)cc1Oc1cc(O)ccc31
| Schlagworte: | 6-Carboxyfluorescein |
| CAS | 3301-79-9 |
| MW: | 376.32 D |
ab 42,00 €
6-FAM (6-Carboxyfluorescein) *Validated for labeling oligos*
Artikelnummer: ABD-106
6-FAM is the other purified isomer of 5(6)-carboxyfluorescein. Complimemtary to 5-FAM isomer, 6-FAM is mainly used in labeling nucleotides and nucleic acids.
| Anwendung: | Labeling |
| CAS | 3301-79-9 |
ab 110,00 €
6-Carboxyfluorescein
Artikelnummer: Cay21233-100
6-Carboxyfluorescein (6-FAM) is a single isomer derivative of 5(6)-carboxyfluorescein (Cay-17172) that can be used to fluorescently label biomolecules through the interaction of carboxylic acid with primary amines. It demonstrates excitation/emission maxima of 492 and 518 nm, respectively.Formal Name:...
| Schlagworte: | 6-FAM, 3',6'-dihydroxy-3-oxo-spiro[isobenzofuran-1(3H),9'-[9H]xanthene]-6-carboxylic acid |
| Anwendung: | Fluorescent amine labeling |
| CAS | 3301-79-9 |
| MW: | 376.3 D |
ab 166,00 €
6-FAM
Artikelnummer: CDX-C0016-M200
Yellow solid. Soluble in DMSO or water (pH ? 5). The amine-reactive fluorescein derivatives are probably the most common fluorescent derivatization reagents for covalently labeling proteins. Carboxyfluorescein is better retained in cells than is fluorescein, its pKa of ~6.5 is lower than the cytosolic pH of most...
| Schlagworte: | 6-Carboxyfluorescein |
| Anwendung: | Protein labeling, Amine-reactive fluorescein derivative |
| CAS | 3301-79-9 |
| MW: | 376,32 D |
ab 108,00 €
