Zu "325465-93-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
1-Oleoyl-2-hydroxy-sn-glycero-3-PA (sodium salt)
Artikelnummer: Cay62215-5
1-Oleoyl-2-hydroxy-sn-glycero-3-PA is a species of lysophosphatidic acid (LPA) containing oleic acid at the sn-1 position. Phosphatidic acid is produced either directly through the action of PLD or through a two step process involving liberation of DAG by PLC followed by phosphorylation of DAG by diglycerol kinase....
| Schlagworte: | Oleoyl-sn-3-glycerophosphate, 9Z-octadecenoic acid, (2R)-2-hydroxy-3-(phosphonooxy)propyl ester, monosodium salt |
| Anwendung: | Bioactive lipid assays |
| CAS | 325465-93-8 |
| MW: | 458.5 D |
ab 44,00 €
1-Oleoyl lysophosphatidic acid sodium
Artikelnummer: TGM-T21654-10mg
Description: 1-Oleoyl lysophosphatidic acid sodium (1-Oleoyl lysophosphatidic acid sodium salt) salt is an Endogenous agonist of LPA1 and LPA2. Target: LPA Receptor. Smiles: CCCCCCCC/C=C\CCCCCCCC(OC[C@@H](O)COP([O-])(O)=O)=O.[Na+]
| Schlagworte: | 1-Oleoyl lysophosphatidic acid sodium salt |
| CAS | 325465-93-8 |
| MW: | 459.51 D |
ab 63,00 €
