Zu "31528-44-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Mycophenolic acid-beta-D-glucuronide
Artikelnummer: TGM-T60104-10mg
Description: Mycophenolic acid glucuronide is the glucuronide metabolite of mycophenolic acid in human plasma. Target: Others. Smiles: COc1c(C)c2COC(=O)c2c(O[C@@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)C(O)=O)c1C\C=C(/C)CCC(O)=O. References: Shipkova M, Niedmann PD, Armstrong VW, Schütz E, Wieland E, Shaw LM, Oellerich...
| Anwendung: | Mycophenolic acid metabolite, internal standard |
| CAS | 31528-44-6 |
| MW: | 496.46 D |
ab 87,00 €
Mycophenolic Acid beta-D-Glucuronide
Artikelnummer: Cay19078-1
Mycophenolic acid beta-D-glucuronide (MPAG) is a metabolite of the immunosuppressant mycophenolic acid (Cay-21716). It is formed from mycophenolic acid by the UDP-glucuronosyltransferase (UGT) isoforms UGT1A9, UGT1A8, UGT1A7, and UGT1A10 in insect cell-derived supersomes expressing the human enzymes. Unlike...
| Schlagworte: | MPAG, Mycophenolic Acid Glucosiduronate,... |
| Anwendung: | Mycophenolic acid metabolite, Internal standard |
| CAS | 31528-44-6 |
| MW: | 496.5 D |
ab 161,00 €
