Zu "314245-33-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
IU1
Artikelnummer: TGM-T6107-100mg
Description: IU1(IC50=4.7 µ M), a reversible, specific human USP14 proteasome inhibitor, can penetrate the cell. Target: DUB, Autophagy. Smiles: Cc1c(ccn1-c1ccc(F)cc1)C(=O)CN1CCCC1. References: Byung-Hoon L, et al. Nature, 2010, 467(7312), 179-184.
| Anwendung: | Deubiquitination inhibitor |
| CAS | 314245-33-5 |
| MW: | 300.37 D |
ab 53,00 €
IU1
Artikelnummer: Cay10617-10
Polybiquitinylation designates proteins for proteasomal degradation. USP14 is one of several deubiquitinating enzymes (DUBs) responsible for shortening proteasome-bound ubiquitin chains, which is known to antagonize the degradation of ubiquitin-protein conjugates. IU1 is a reversible, small molecule inhibitor of...
| Schlagworte: | 1-[1-(4-fluorophenyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-(1-pyrrolidinyl)-ethanone |
| Anwendung: | Deubiquitination inhibitor |
| CAS | 314245-33-5 |
| MW: | 300.4 D |
ab 52,00 €
