Zu "308831-61-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Sufugolix
Artikelnummer: TGM-T3538-100mg
Description: Sufugolix (TAK-013) is a potent and orally available luteinizing hormone-releasing hormone (LHRH) receptor antagonist. Target: LHRH. Smiles: CONC(=O)Nc1ccc(cc1)-c1sc2n(Cc3c(F)cccc3F)c(=O)n(-c3ccccc3)c(=O)c2c1CN(C)Cc1ccccc1. References: Sasaki S, et al. Discovery of a thieno[2,3-d]pyrimidine-2,4-dione...
| Schlagworte: | TAK-013 |
| Anwendung: | Gonadotropin-releasing hormone receptor (GnRHR) antagonist |
| CAS | 308831-61-0 |
| MW: | 667.72 D |
ab 35,00 €
Sufugolix
Artikelnummer: Cay27996-1
Sufugolix is a gonadotropin-releasing hormone (GnRH) receptor antagonist (IC50 = 0.1 nM). Sufugolix inhibits GnRH-induced arachidonic acid (Cay-90010, Cay-90010.1, Cay-10006607) release in CHO cells expressing human recombinant or monkey recombinant GnRH (IC50s = 0.1 and 10 nM, respectively), but not the rat GnRH...
| Schlagworte: | TAK-013,... |
| Anwendung: | Gonadotropin-releasing hormone receptor (GnRHR) antagonist |
| CAS | 308831-61-0 |
| MW: | 667.7 D |
ab 48,00 €
