Zu "30751-05-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Troxipide
Artikelnummer: TGM-T6710-100mg
Description: Troxipide (Aplace), a new-type systemic non-antisecretory gastric cytoprotective agent, which is mucus-secreting, anti-ulcer, and anti-inflammatory properties irrespective of pH of stomach or duodenum. Target: Others. Smiles: COc1cc(cc(OC)c1OC)C(=O)NC1CCCNC1. References: Kusugami K, et al. Dig Liver...
| Schlagworte: | Aplace |
| Anwendung: | Antiulcerative |
| CAS | 30751-05-4 |
| MW: | 294.35 D |
49,00 €
Troxipide
Artikelnummer: Cay30616-1
Troxipide is an antiulcerative agent. It inhibits production of superoxide induced by N-formyl-L-methionyl-L-leucyl-L-phenylalanine (fMLP, Cay-21495) in, and IL-8-induced migration of, isolated human polymorphonuclear (PMN) neutrophils when used at a concentration of 1 mM. Troxipide (100 and 200 mg/kg, i.p.) reduces...
| Schlagworte: | KU-54, 3,4,5-trimethoxy-N-3-piperidinyl-benzamide |
| Anwendung: | Gastric mucosal protectant, antiulcerative agent |
| CAS | 30751-05-4 |
| MW: | 294.4 D |
ab 94,00 €
