Zu "30315-93-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Asymmetric dimethylarginine
Artikelnummer: TGM-T7682-100mg
Description: Asymmetric dimethylarginine [an endogenous inhibitor of nitric oxide synthase (NOS)], is a compound that inhibits the enzyme responsible for producing nitric oxide. Target: NO Synthase, NOD, Endogenous Metabolite. Smiles: CN(C)N=CNCCC[C@H](N)C(O)=O. References: Anna M Wieczór, Radoslaw Wieczór, Arleta...
| Anwendung: | Endogenous NOS inhibitor |
| CAS | 30315-93-6 |
| MW: | 202.25 D |
ab 43,00 €
NG,NG-dimethyl-L-Arginine
Artikelnummer: Cay33576-10
NG,NG-dimethyl-L-arginine (ADMA) is an endogenous inhibitor of nitric oxide synthase (NOS). It is formed from arginine by protein arginine methyltransferases (PRMTs) and degraded by dimethylarginine dimethylaminohydrolases (DDAHs) and alanine-glyoxylate aminotransferase 2 (AGXT2). ADMA levels are increased...
| Schlagworte: | ADMA, Asymmetric dimethylarginine, N5-[(dimethylamino)iminomethyl]-L-ornithine |
| Anwendung: | Endogenous NOS inhibitor |
| CAS | 30315-93-6 |
| MW: | 202.3 D |
ab 44,00 €
