Zu "300842-64-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NVP-ACC789
Artikelnummer: TGM-T3463-100mg
Description: ACC-789 (NVP-ACC789 (ZK202650), ZK-202650) is an effective, specific and orally active inhibitor of the VEGF receptor tyrosine kinases. Target: VEGFR, PDGFR. Smiles: Cc1ccc(Nc2nnc(Cc3ccncc3)c3ccccc23)cc1Br. References: Tille JC, et al. Vascular endothelial growth factor (VEGF) receptor-2 antagonists...
| Schlagworte: | ZK202650, ACC-789 |
| Anwendung: | VEGFR inhibitor |
| CAS | 300842-64-2 |
| MW: | 405.29 D |
ab 39,00 €
NVP-ACC789
Artikelnummer: Cay23458-1
NVP-ACC789 is an inhibitor of VEGF receptor tyrosine kinases (VEGFRs, IC50s = 0.38, 0.02, 0.18, and 0.23 µM for human VEGFR1, 2, 3, and mouse Vegfr2, respectively). It is selective for VEGFRs over FGFRs and PDGFRalpha (IC50s = >10 µM) but has activity at PDGFRbeta (IC50 = 1.4 µM) in an enzyme assay. NVP-ACC789...
| Schlagworte: | N-(3-bromo-4-methylphenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine |
| Anwendung: | VEGFR inhibitor |
| CAS | 300842-64-2 |
| MW: | 405.3 D |
ab 60,00 €
