Zu "300586-90-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
OAC1
Artikelnummer: TGM-T2040-100mg
Description: OAC1 (BAS 00287861) is a compound activating Octamer-binding transcription factor 4 (Oct4). It enhances the iPSC reprogramming efficiency and accelerates the reprogramming process. Target: OCT. Smiles: O=C(Nc1cc2cc[nH]c2cn1)c1ccccc1. References: Li W, et al. Proc Natl Acad Sci U S A, 2012, 109(51),...
| Schlagworte: | BAS 00287861 |
| Anwendung: | Oct4 activating compound |
| CAS | 300586-90-7 |
| MW: | 237.26 D |
ab 31,00 €
OAC1
Artikelnummer: Cay14102-10
Octamer-binding transcription factor 4 (Oct4) is a transcription factor that, with Sox2, Klf4, and c-Myc, is involved in the reprogramming of somatic cells to produce pluripotent stem cells. OAC1 is an Oct4-activating compound that activates expression through the Oct4 gene promoter. In cells expressing Oct4 with...
| Schlagworte: | N-1H-pyrrolo[2,3-c]pyridin-5-yl-benzamide |
| Anwendung: | Oct4 activating compound |
| CAS | 300586-90-7 |
| MW: | 237.3 D |
ab 117,00 €
