Zu "299157-54-3" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Biotinoyl tripeptide-1
Artikelnummer: TGM-TP2373-250mg
Description: Biotinoyl tripeptide-1 can produce hair follicles by promoting scalp micro-circulation and reduce follicle atrophy and aging. Smiles: C(CCCC(NCC(N[C@@H](CC1=CN=CN1)C(N[C@@H](CCCCN)C(O)=O)=O)=O)=O)[C@H]2[C@@]3([C@](CS2)(NC(=O)N3)[H])[H]. References: Lee CK, Cheong C, Jeon YH. Substrate recognition...
| Schlagworte: | Biotin-GHK, BiotinGHK, Biotin GHK |
| CAS | 299157-54-3 |
| MW: | 566.67 D |
ab 77,00 €
Biotin Tripeptide-1
Artikelnummer: Cay27153-100
Biotin tripeptide-1 is an extracellular matrix (ECM) peptide that has been conjugated to biotin (Cay-22582). It stimulates the production of collagen IV and laminin in dermal and epidermal cells ex vivo. Biotin tripeptide-1 localizes to the peri-pilial zone of isolated cultured human hair follicles, induces...
| Schlagworte: | Biotinoyl Tripeptide-1, Biotinyl-GHK, Biotinyl-Gly-His-Lys,... |
| Anwendung: | Biotinylated extracellular matrix (ECM) peptide |
| CAS | 299157-54-3 |
| MW: | 566.7 D |
ab 44,00 €
Biotinoyl Tripeptide-1
Artikelnummer: CSB-DT1724.1
Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...
| Schlagworte: | Biotin-Gly-His-Lys, Biotin-GHK |
| Anwendung: | Cosmetic peptide |
| CAS | 299157-54-3 |
| MW: | 566.7 D |
286,00 €
