Zu "29621-88-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
L-Selenocystine
Artikelnummer: TGM-T34603-100mg
Description: L-Selenocystine (L-Selenocystine) can be used as a building block in biologically active selenol compounds. Target: Others. Smiles: [C@H](C[Se][Se]C[C@@H](C(O)=O)N)(C(O)=O)N. References: Uehara W, Yoshida S, Emaya Y, Fuchigami T, Haratake M, Nakayama M. Selenoprotein L-inspired nano-vesicular peroxidase...
| Schlagworte: | L-Selenocystine |
| Anwendung: | Thioredoxin reductase substrate |
| CAS | 29621-88-3 |
| MW: | 334.09 D |
ab 40,00 €
L-Selenocystine
Artikelnummer: Cay17793-1
L-Selenocystine is a diselenide-bridged amino acid that may be confused with selenocysteine (Sec), which is a rare amino acid featuring a single selenium atom. L-Selenocystine is a redox-active selenium compound that has both anti- and pro-oxidant actions. This compound can be reduced by low molecular thiols and...
| Schlagworte: | Seleno-L-cystine, 3,3'-diselenobis-L-alanine |
| Anwendung: | Thioredoxin reductase substrate |
| CAS | 29621-88-3 |
| MW: | 334.1 D |
ab 44,00 €
