Zu "288250-47-5" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Y-320
Artikelnummer: TGM-T1846-100mg
Description: Y-320 is a new phenylpyrazoleanilide immunomodulator. Target: Interleukin, Lipase, IL Receptor. Smiles: Cc1c(cnn1-c1ccc(Cl)cc1)C(=O)Nc1ccc(N2CCC(CC2)N2CCOCC2)c(c1)C#N. References: Ushio H, et al. Pharmaceuticals (Basel). 2013, 7(1), 1-17.
| Schlagworte: | Y320 |
| Anwendung: | Immunomodulatory agent |
| CAS | 288250-47-5 |
| MW: | 505.01 D |
ab 40,00 €
Y320
Artikelnummer: Cay16314-1
IL-15 is a pro-inflammatory cytokine with roles in cancer and autoimmune diseases, including rheumatoid arthritis, inflammatory bowel disease, psoriasis, celiac disease, and alopecia areata. IL-15 can induce IL-17 production by CD4 T cells. Y320 is an inhibitor of the release of IL-17 by CD4 T cells stimulated with...
| Schlagworte: | 1-(4-chlorophenyl)-N-[3-cyano-4-[4-(4-morpholinyl)-1-piperidinyl]phenyl]-5-methyl-1H-pyrazole-4-carboxamide |
| Anwendung: | Immunomodulatory agent |
| CAS | 288250-47-5 |
| MW: | 505 D |
ab 44,00 €
Y-320
Artikelnummer: LKT-Y0002.1
Phenylpyrazoleanilide, IL-17 production inhibitor.
| Schlagworte: | Y320 |
| Anwendung: | Phenylpyrazoleanilide, IL-17 production inhibitor |
| CAS | 288250-47-5 |
| MW: | 505.02 D |
ab 156,00 €
