Zu "284028-89-3" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
XAV-939
Artikelnummer: TGM-T1878-100mg
Description: XAV-939 (NVP-XAV939) is a Tankyrase (TNKS) inhibitor that inhibits TNKS1 and TNKS2 (IC50=11/4 nM). XAV-939 selectively inhibits Wnt/beta-catenin-mediated transcription. Target: PARP, Wnt/beta-catenin. Smiles: FC(F)(F)C1=CC=C(C=C1)C1=NC(=O)C2=C(CCSC2)N1. References: Huang SM, et al. Tankyrase inhibition...
| Schlagworte: | NVP-XAV939, XAV939 |
| Anwendung: | TNKS inhibitor |
| CAS | 284028-89-3 |
| MW: | 312.31 D |
ab 48,00 €
XAV939
Artikelnummer: Cay13596-1
The Wnt signaling pathway is integral to normal biological processes and inappropriately active in many cancers. It is regulated through degradation of the downstream effector beta-catenin via a complex consisting of the tumor suppressor APC, axin, and glycogen synthase kinase 3 (GSK3). Axin is the...
| Schlagworte: | 3,5,7,8-tetrahydro-2-[4-(trifluoromethyl)phenyl]-4H-thiopyrano[4,3-d]pyrimidin-4-one |
| Anwendung: | TNKS inhibitor |
| CAS | 284028-89-3 |
| MW: | 312.3 D |
ab 21,00 €
XAV-939
Artikelnummer: LKT-X0384.5
Tankyrase inhibitor.
| Schlagworte: | 2-[4-(trifluoromethyl)phenyl]-7,8-dihydro-5H-thiino[4,3-d]pyrimidin-4-ol |
| Anwendung: | Tankyrase inhibitor |
| CAS | 284028-89-3 |
| MW: | 312.31 D |
ab 98,00 €
