Zu "2786829-70-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
BCP-T.A
Artikelnummer: TGM-T62827-10mg
Description: BCP-T.A is an ferroptosis inducer that acts by binding to GPX4. Target: GPX, Ferroptosis. Smiles: O=C(C=1N=C(C#C)SC1)N2CCN(CC2)C(C3=CC=C(Cl)C=C3)C4=CC=C(Cl)C=C4. References: Endri Karaj, et al. Design, Synthesis, and Monoamine Oxidase B Selective Inhibitory Activity of N-Arylated Heliamine Analogues. J...
| Anwendung: | Ferroptosis inducer |
| CAS | 2786829-70-5 |
| MW: | 456.39 D |
ab 77,00 €
BCP-T.A.
Artikelnummer: Cay37659-1
BCP-T.A. is a ferroptosis inducer. It induces ferroptosis in NCI H522 non-small cell lung cancer (NSCLC) cells (IC50 = 17 nM), an effect that can be blocked by the ferroptosis inhibitor liproxstatin-1 (Cay-17730). BCP-T.A. binds to glutathione peroxidase (GPX4) and increases the accumulation of lipid peroxides in...
| Schlagworte: | [4-[bis(4-chlorophenyl)methyl]-1-piperazinyl](2-ethynyl-4-thiazolyl)-methanone |
| Anwendung: | Ferroptosis inducer |
| CAS | 2786829-70-5 |
ab 43,00 €
