Zu "276702-15-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SB-332235
Artikelnummer: TGM-T34544-10mg
Description: SB-332235 is an effective specific CXCR2 antagonist. And it is effectively inhibited CS-induced neutrophilia in a dose-dependent manner. Target: Others. Smiles: N(C(NC1=C(Cl)C(Cl)=CC=C1)=O)C2=C(O)C(S(N)(=O)=O)=C(Cl)C=C2. References: Wang Y, Luo W, Stricker R, Reiser G. Protease-activated receptor-1...
| Schlagworte: | SB 332235, SB332235 |
| Anwendung: | CXCR2 antagonist |
| CAS | 276702-15-9 |
| MW: | 410.66 D |
ab 108,00 €
SB-332235
Artikelnummer: Cay32869-1
SB-332235 is an antagonist of chemokine (C-X-C motif) receptor 2 (CXCR2, IC50 = 9.3 nM in CHO cell membranes expressing the recombinant human receptor). It is selective for CXCR2 over CXCR1 (IC50 = 9,633 nM). SB-332235 (10 ng/ml) inhibits migration of isolated human peripheral blood monocytes induced by chemokine...
| Schlagworte: | 6-chloro-3-[[[(2,3-dichlorophenyl)amino]carbonyl]amino]-2-hydroxy-benzenesulfonamide |
| Anwendung: | CXCR2 antagonist |
| CAS | 276702-15-9 |
| MW: | 410.7 D |
ab 60,00 €
