Zu "2765081-21-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NEU
RMC-6236
Artikelnummer: Cay41982-1
RMC-6236 is a non-covalent inhibitor of GTP-bound RAS. It binds to peptidyl-prolyl cis-trans isomerase A (PPIase A), also known as cyclophilin A (CypA, Kd = 55.3 nM) to form a binary complex that then binds to wild-type K-Ras, K-Ras(G12V), and K-Ras(G12D) (Kds = 131, 364, and 154 nM, respectively). RMC-6236 forms a...
| Schlagworte: | (1S,2S)-N-[(2R,14S,18S)-1-ethyl-18,19,20,21-tetrahydro-2-[2-[(1S)-1-methoxyethyl]-5-(4-methyl-1-piperazinyl)-3-pyridinyl]-... |
| Anwendung: | Non-covalent GTP-bound Ras inhibitor |
| CAS | 2765081-21-6 |
| MW: | 811.1 D |
ab 108,00 €
RMC-6236
Artikelnummer: TGM-T74698-100mg
Description: RMC-6236 is a RAS(ON)MULTI inhibitor with anticancer activity and is used in the study of advanced malignant solid tumors and colorectal cancer. Target: Ras. Smiles: O=C1OCC(C)(C)CC=2C3=CC(=CC=C3N(C2C=4C=C(C=NC4C(OC)C)N5CCN(C)CC5)CC)C=6N=C(SC6)CC(NC(=O)C7CC7C)C(=O)N8NC1CCC8. References: Ethan AHLER, et...
| Schlagworte: | RMC6236, RMC-6236 |
| CAS | 2765081-21-6 |
| MW: | 811.05 D |
ab 290,00 €
