Zu "2705841-52-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
8RK64
Artikelnummer: TGM-T69539-100mg
Description: 8RK64 is a covalent UCHL1 inhibitor (IC50: 0.32 µM). Target: Others. Smiles: C(CN=[N+]=[N-])(=O)N1CC2=C(N=C(NC(=O)[C@@H]3CN(C#N)CC3)S2)CC1
| Anwendung: | Covalent UCH-L1 inhibitor |
| CAS | 2705841-52-5 |
| MW: | 360.4 D |
ab 1.638,00 €
8RK64
Artikelnummer: Cay41148-1
8RK64 is a covalent inhibitor of ubiquitin C-terminal hydrolase L1 (UCH-L1, IC50 = 0.32 µM) and a click chemistry reagent. It is selective for UCH-L1 over UCH-L3 and UCH-L5 (IC50s = 216 and >1,000 µM, respectively). 8RK64 has been linked to fluorophores containing alkyne groups via copper(I)-catalyzed azide/alkyne...
| Schlagworte: | N-[5-(2-azidoacetyl)-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridin-2-yl]-1-cyano-3S-pyrrolidinecarboxamide |
| Anwendung: | Covalent UCH-L1 inhibitor |
| CAS | 2705841-52-5 |
| MW: | 360.4 D |
ab 47,00 €
