Zu "26645-35-2" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Phallacidin
Artikelnummer: TGM-T40298-1mg
Description: Phallacidin, a phallotoxin family member, targets and binds to F-actin in mushroom toxins. Target: Others. Smiles: [H][C@@]12C[C@H](O)CN1C(=O)[C@]1([H])CSc3[nH]c4ccccc4c3C[C@]([H])(NC(=O)[C@H](C)NC2=O)C(=O)N[C@@H](CC(C)(O)CO)C(=O)N[C@@H](C(C)C)C(=O)N[C@]([H])([C@H](O)C(O)=O)C(=O)N1. References: L S...
| Anwendung: | Actin fiber binding, carboxyl group for coupling reactions |
| CAS | 26645-35-2 |
| MW: | 846.91 D |
524,00 €
Phallacidin
Artikelnummer: Cay18146-1
Phallacidin is a natural mycotoxin first isolated from the death cap mushroom, A. phalloides. It binds filamentous actin (F-actin) like phalloidin (Cay-18039), but contains a carboxyl group for coupling reactions.Formal Name: cyclic...
| Schlagworte: | cyclic... |
| Anwendung: | Actin fiber binding, carboxyl group for coupling reactions |
| CAS | 26645-35-2 |
| MW: | 846.9 D |
287,00 €
Phallacidin
Artikelnummer: LKT-P2303.1
A actin filament stabilizer isolated from Amanita phalloides. It differs from Phalloidin in that it contains a carboxy group for coupling reactions.
| Anwendung: | Actin filament stabilizer |
| CAS | 26645-35-2 |
| MW: | 846,91 D |
ab 770,00 €
