Zu "266359-83-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Reparixin
Artikelnummer: TGM-T4163-100mg
Description: Reparixin (Repertaxin) is a potent inhibitor of both CXCL8 receptors CXCR1/2, it inhibits weakly CXCR2-mediated cell migration (IC50=100 nM), whereas it strongly blocks CXCR1-mediated chemotaxis (IC50=1 nM). Target: CXCR. Smiles: CC(C)Cc1ccc(cc1)[C@@H](C)C(=O)NS(C)(=O)=O. References: Moriconi A, et al....
| Schlagworte: | DF 1681Y, Repertaxin |
| Anwendung: | Targets C-X-C chemokine receptor type 1 (CXCR1, IL8RA, CD181) |
| CAS | 266359-83-5 |
| MW: | 283.39 D |
ab 48,00 €
Reparixin
Artikelnummer: Cay17350-1
Reparixin is an allosteric antagonist of chemokine (C-X-C motif) receptor 1 (CXCR1) and CXCR2 (IC50s = 1 and 100 nM, respectively). In vivo, reparixin (3, 15, and 30 mg/kg) reduces ischemia and reperfusion-induced hepatic polymorphonuclear leukocyte (PMN) recruitment, hepatic myeloperoxidase (MPO) levels, and serum...
| Schlagworte: | DF 1681Y, Repertaxin, (alphaR)-alpha-methyl-4-(2-methylpropyl)-N-(methylsulfonyl)-benzeneacetamide |
| Anwendung: | Allosteric CXCR1 / CXCR2 antagonist |
| CAS | 266359-83-5 |
| MW: | 283.4 D |
ab 36,00 €
