Zu "2601-90-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
N-Oleoyl glycine
Artikelnummer: TGM-T13803-100mg
Description: N-Oleoyl glycine, a lipoamino acid, was able to promote 3T3-L1 adipogenesis through the activation of CB1 receptor and the enhancement of insulin-mediated Akt signaling pathway. Target: Akt, PPAR, Endogenous Metabolite, Cannabinoid Receptor. Smiles: CCCCCCCC\C=C/CCCCCCCC(=O)NCC(O)=O. References: Wang...
| Anwendung: | Bioactive lipid assays |
| CAS | 2601-90-3 |
| MW: | 339.51 D |
ab 40,00 €
N-Oleoyl Glycine
Artikelnummer: Cay90269-10
N-Oleoyl glycine is a putative substrate for peptidyl glycine alpha-amidating enzyme in the biosynthesis of oleoyl amide.Formal Name: N-[(9Z)-1-oxo-9-octadecen-1-yl]-glycine. CAS Number: 2601-90-3. Molecular Formula: C20H37NO3. Formula Weight: 339.5. Purity: >98%. Formulation: (Request formulation change), A...
| Schlagworte: | N-(9Z-octadecenoyl)-glycine |
| Anwendung: | Bioactive lipid assays |
| CAS | 2601-90-3 |
| MW: | 339.5 D |
ab 52,00 €
