Zu "2591-17-5" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
D-Luciferin
Artikelnummer: TGM-T3313-100mg
Description: D-Luciferin (D-(-)-Luciferin) is a popular bioluminescent substrate of luciferase in the presence of ATP, used in luciferase-based bioluminescence imaging and cell-based high-throughput screening applications. Target: Others. Smiles: OC(=O)[C@H]1CS\C(N1)=c1\nc2C=CC(=O)C=c2s1. References: Hauber R, et...
| Schlagworte: | D-(-)-Luciferin, Firefly luciferin |
| Anwendung: | Bioluminescence assays |
| CAS | 2591-17-5 |
| MW: | 280.32 D |
ab 45,00 €
D-Luciferin
Artikelnummer: Cay25836-100
D-Luciferin is a chemiluminescent substrate of firefly luciferase. It produces light upon oxidative decarboxylation by luciferase in the presence of ATP. D-Luciferin can be employed to assay the expression of the luciferase gene linked to a promoter of interest. Alternatively, D-luciferin and luciferase can be used...
| Schlagworte: | Firefly Luciferin, (4S)-4,5-dihydro-2-(6-hydroxy-2-benzothiazolyl)-4-thiazolecarboxylic acid |
| Anwendung: | Chemiluminescent firefly luciferase substrate |
| CAS | 2591-17-5 |
| MW: | 280.3 D |
ab 50,00 €
D-Luciferin, free acid *UltraPure Grade*
Artikelnummer: ABD-12501
Luciferin is the most popular and versatile bioluminescent substrate.
| Anwendung: | Bioluminescence assays |
| CAS | 2591-17-5 |
ab 108,00 €
D-Luciferin firefly, free acid
Artikelnummer: LKT-L8008.25
Firefly luciferin is the light-emitting compound found in many fireflies.
| Schlagworte: | D(-)-Luciferin, (4S)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydrothiazole-4-carboxylic acid |
| CAS | 2591-17-5 |
| MW: | 280.32 D |
ab 123,00 €
