Zu "25679-24-7" wurden 1 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Cholecystokinin Octapeptide, desulfated
Artikelnummer: TGM-TP2204-1mg
Description: Non-sulfated form of the C-terminal octapeptide of CCK. Target: Others. Smiles: CSCC[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)CC(O)=O)C(=O)NCC(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](Cc1ccccc1)C(N)=O. References: Ma F Y, Flanc R S, Tesch G H, et al. A...
| Schlagworte: | CCK Octapeptide, non-sulfated |
| CAS | 25679-24-7 |
| MW: | 1063.21 D |
86,00 €
