Zu "25526-93-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Alovudine
Artikelnummer: TGM-T4683-100mg
Description: Alovudine (3'-Deoxy-3'-fluorothymidine) is a marker of DNA synthesis. Alovudine is less susceptible to inflammatory changes than 18F-Fluorodeoxyglucose (FDG) and is a better biomarker in pancreatic cancer. Target: Antiviral. Smiles: Cc1cn([C@H]2C[C@H](F)[C@@H](CO)O2)c(=O)[nH]c1=O. References: Ghosn, J.,...
| Schlagworte: | 3'-Deoxy-3'-fluorothymidine |
| Anwendung: | Targets HIV-1 reverse transcriptase / ribonuclease H [EC:2.7.7.49 2.7.7.7 3.1.26.13] (RT) |
| CAS | 25526-93-6 |
| MW: | 244.22 D |
ab 31,00 €
3'-Deoxy-3'-fluorothymidine
Artikelnummer: Cay36519-100
3'-Deoxy-3'-fluorothymidine is a nucleoside analog. It is phosphorylated by thymidine kinase 1 (TK1) but not TK2 and also inhibits TK1 and TK2 (Kis = 6 and 10 µM, respectively). 3'-Deoxy-3'-fluorothymidine inhibits HIV-1 reverse transcriptase (EC50 = 5 nM) and the replication of HIV-1 in MT-4 human T cell leukemia...
| Schlagworte: | Alovudine, CL 184,824, FLT, MIV-310, NSC 140025, 3'-deoxy-3'-fluoro-thymidine |
| Anwendung: | Nucleoside analog |
| CAS | 25526-93-6 |
| MW: | 244.2 D |
ab 116,00 €
