Zu "254877-67-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ataciguat
Artikelnummer: TGM-T21607-100mg
Description: Ataciguat (HMR-1766) (HMR-1766) is a potent and specific soluble guanylate cyclase (sGC) activator. Target: Others, Guanylate cyclase. Smiles: N(S(=O)(=O)C1=CC=C(Cl)S1)C2=C(C(NC3=CC=C(S(=O)(=O)N4CCOCC4)C=C3)=O)C=C(Cl)C=C2. References: Martinelli AM, et, al. In Endothelial Cells, the Activation or...
| Schlagworte: | HMR-1766 |
| Anwendung: | sGC, oxidized, heme-free, form, activator |
| CAS | 254877-67-3 |
| MW: | 576.49 D |
ab 45,00 €
Ataciguat
Artikelnummer: Cay16371-1
Soluble guanylate cyclase (sGC) is the primary cellular receptor for NO. NO binds and activates a heme group in sGC, initiating the conversion of GTP to the second messenger cGMP. cGMP subsequently mediates a number of signaling cascades leading to vasorelaxation and inhibiting smooth muscle proliferation, leukocyte...
| Schlagworte: | HMR 1766, 5-chloro-2-[[(5-chloro-2-thienyl)sulfonyl]amino]-N-[4-(4-morpholinylsulfonyl)phenyl]-benzamide |
| Anwendung: | sGC, oxidized, heme-free, form, activator |
| CAS | 254877-67-3 |
| MW: | 576.5 D |
ab 111,00 €
