Zu "252935-94-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CHIR-98014
Artikelnummer: TGM-T2608-100mg
Description: CHIR-98014 (CT98014) is a selective GSK3 inhibitor, potentiate insulin activation of glucose transport and utilization in vitro and in vivo. Target: Src, GSK-3, FGFR, S6 Kinase. Smiles: ClC1=C(C=2C(=CN=C(NCCNC=3N=C(N)C(N(=O)=O)=CC3)N2)N4C=CN=C4)C=CC(Cl)=C1. References: Ring DB,et al. Diabetes. 2003,...
| Schlagworte: | CHIR98014, CHIR 98014, CT98014 |
| Anwendung: | GSK3alpha / GSK3beta inhibitor |
| CAS | 252935-94-7 |
| MW: | 486.31 D |
ab 67,00 €
CHIR98014
Artikelnummer: Cay15578-1
The two isoforms of glycogen synthase kinase 3, GSK3alpha and GSK3beta, constitutively phosphorylates and inactivates glycogen synthase, preventing glycogen synthesis. They also phosphorylate proteins that are relevant to Alzheimer's disease and osteogenesis. CHIR98014 is a reversible, cell-permeable inhibitor of...
| Schlagworte: | N6-[2-[[4-(2,4-dichlorophenyl)-5-(1H-imidazol-2-yl)-2-pyrimidinyl]amino]ethyl]-3-nitro-2,6-pyridinediamine |
| Anwendung: | GSK3alpha / GSK3beta inhibitor |
| CAS | 252935-94-7 |
| MW: | 486.3 D |
ab 111,00 €
