Zu "2477651-11-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NEU
USP8-IN-2
Artikelnummer: Cay41599-1
USP8-IN-2 is an inhibitor of ubiquitin-specific protease 8 (USP8, IC50 = 6 µM).Formal Name: N-(5-chloro-2-methoxyphenyl)-N'-[1-[6-(trifluoromethyl)-2-pyridinyl]-4-piperidinyl]-thiourea. CAS Number: 2477651-11-7. Synonyms: Ubiquitin-specific Protease 8-IN-2, Ubiquitin-specific Protease 8 Inhibitor 2, USP Inhibitor 2....
| Schlagworte: | Ubiquitin-specific Protease 8 Inhibitor 2, Ubiquitin-specific Protease 8-IN-2, USP Inhibitor 2,... |
| Anwendung: | USP8 inhibitor |
| CAS | 2477651-11-7 |
| MW: | 444.9 D |
ab 73,00 €
USP8-IN-2
Artikelnummer: TGM-T67876-100mg
Description: USP8-IN-2 is a potent inhibitor of the deubiquitinating enzymes USP7 and USP8, with an IC50 of 4.0 µM against USP8D. USP8-IN-2 is a potential compound for the treatment of cancer and viral infections. Target: DUB. Smiles: C(F)(F)(F)C1=NC(=CC=C1)N2CCC(NC(NC3=C(OC)C=CC(Cl)=C3)=S)CC2. References: Li...
| CAS | 2477651-11-7 |
| MW: | 444.9 D |
ab 114,00 €
