Zu "2460249-19-6" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
PF-07104091
Artikelnummer: LKT-P200091.1
PF-07104091 is a selective CDK2 inhibitor. SMILES: CC(C)NC(=O)OC1CCC(C1)C2=CC(=NN2)NC(=O)C3=CC(=NN3C)COC
| Schlagworte: | PF-07104091, PF 07104091, PF07104091, PF-7104091, PF 7104091, PF7104091,... |
| Anwendung: | CDK2 inhibitor |
| CAS | 2460249-19-6 |
| MW: | 404.47 D |
ab 229,00 €
PF-07104091
Artikelnummer: Cay41356-1
PF-07104091 is an inhibitor of cyclin-dependent kinase 2 (Cdk2, Ki = 1.16 nM). It is selective for Cdk2 over glycogen synthase kinase 3beta (GSK3beta, Ki = 537.81 nM). PF-07104091 decreases proliferation of TOV-21G and OVCAR-3 ovarian and HCT116 colorectal cancer cells (IC50s = 4.8, 0.59, and 0.88 µM, respectively)....
| Schlagworte: | Tagtociclib, carbamic acid... |
| Anwendung: | Cdk2 inhibitor |
| CAS | 2460249-19-6 |
| MW: | 404.5 D |
ab 75,00 €
PF07104091
Artikelnummer: TGM-T9712-100mg
Description: PF07104091 inhibits CDK2, which may lead to cell cycle arrest, induce apoptosis and inhibit tumor cell proliferation. Target: CDK. Smiles: N(C(=O)C1=CC(COC)=NN1C)C2=CC(=NN2)[C@@H]3C[C@H](OC(NC(C)C)=O)CC3. References: Chen Y, Cai Q, Pan C, Liu W, Li L, Liu J, Gao M, Li X, Wang L, Rao Y, Yang H, Cheng G....
| Schlagworte: | PF-07104091 |
| Anwendung: | Targets cyclin-dependent kinase 2 [EC:2.7.11.22] (CDK2) |
| CAS | 2460249-19-6 |
| MW: | 404.46 D |
ab 371,00 €
