Zu "24435-25-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NAEPA
Artikelnummer: TGM-T25847-100mg
Description: NAEPA, an LPA mimetic, is a selective agonist of the lysophosphatidic acid-1 (LPA1) receptor. Target: Others. Smiles: C(C(NCCOP(=O)(O)O)=O)CCCCCC/C=C\CCCCCCCC. References: Woclawek-Potocka I, Kondraciuk K, Skarzynski DJ. Lysophosphatidic acid stimulates prostaglandin E2 production in cultured stromal...
| Anwendung: | Selective LPA1 receptor agonist |
| CAS | 24435-25-4 |
| MW: | 405.51 D |
ab 1.521,00 €
Oleoyl Ethanolamide Phosphate
Artikelnummer: Cay22886-1
Oleoyl ethanolamide phosphate (OEA-P) is a lysophosphatidic acid (LPA) mimetic, LPA receptor agonist, and phosphate ester of oleoyl ethanolamide (OEA, Cay-90265). It selectively increases [35S]GTPgammaS binding to HEK293T cell membranes expressing LPA1 and LPA2 over LPA3 receptors. OEA-P induces calcium mobilization...
| Schlagworte: | NAEPA, N-oleoyl ethanolamide phosphoric acid, OEA-P, N-[2-(phosphonooxy)ethyl]-9Z-octadecenamide |
| Anwendung: | Selective LPA1 receptor agonist |
| CAS | 24435-25-4 |
| MW: | 405.5 D |
ab 94,00 €
