Zu "2387510-80-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
MRK-740
Artikelnummer: Cay26387-1
MRK-740 is an inhibitor of the lysine methyltransferase PR/SET domain 9 (PRDM9, IC50 = 80 nM). It inhibits PRDM9-dependent trimethylation of ectopic histone H3K4 (IC50 = 0.8 µM) and endogenous H3K4 in HEK293 cells in a concentration-dependent manner. MRK-740 induces meiotic defects in mouse spermatocytes.Formal...
| Schlagworte: | 4-[3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-1-methyl-9-(2-methyl-4-pyridinyl)-1,4,9-triazaspiro[5.5]undecane |
| Anwendung: | PRDM9 inhibitor |
| CAS | 2387510-80-5 |
| MW: | 464.6 D |
ab 44,00 €
MRK-740
Artikelnummer: TGM-T62957-100mg
Description: MRK-740 is a potent and selective inhibitor of PRDM9 histone methyltransferase.MRK-740 inhibits other histone methyltransferases and inhibits PRDM9-dependent H3K4 trimethylation. Target: Histone Methyltransferase. Smiles: COc1cc(OC)cc(c1)-c1noc(n1)N1CCN(C)C2(CCN(CC2)c2ccnc(C)c2)C1. References: Abdellah...
| CAS | 2387510-80-5 |
| MW: | 464.56 D |
ab 103,00 €
