Zu "2378755-50-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Erythromycin-13C-d3
Artikelnummer: TGM-TMIH-0221-1mg
Description: Erythromycin-13C-d3 is the 13C and deuterated compound of Erythromycin. Smiles: [2H][13C]([2H])([2H])N(C)[C@H]1C[C@@H](C)O[C@@H](O[C@@H]2[C@@H](C)[C@H](O[C@H]3C[C@@](C)(OC)[C@@H](O)[C@H](C)O3)[C@@H](C)C(=O)O[C@H](CC)[C@@](C)(O)[C@H](O)[C@@H](C)C(=O)[C@H](C)C[C@@]2(C)O)[C@@H]1O
| Anwendung: | GC-MS, LC-MS, NMR, internal standard |
| CAS | 2378755-50-9 |
| MW: | 737.94 D |
ab 683,00 €
Erythromycin-13C-d3
Artikelnummer: Cay25310-1
Erythromycin-13C-d3 is intended for use as an internal standard for the quantification of erythromycin (Cay-16486) by GC- or LC-MS. Erythromycin is a macrolide antibiotic that inhibits bacterial protein synthesis by targeting the 50S ribosomal subunit, blocking the progression of nascent polypeptide chains. It is...
| Schlagworte: | (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-14-ethyl-7,12,13-trihydroxy-4-(((2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyltetrahyd... |
| Anwendung: | GC-MS, LC-MS, NMR, internal standard |
| CAS | 2378755-50-9 |
| MW: | 738 D |
481,00 €
