Zu "233691-67-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Boc-Lys(Ac)-AMC
Artikelnummer: TGM-T36578-10mg
Description: Commendamide (N-acyl-3-hydroxypalmitoyl-glycine) is a newly discovered GPCR G2A/GPR132 agonist (EC50=11.8 µM) that isolated from Bacteroides vulgatus. Target: Others. Smiles: CC(=O)NCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)Nc1ccc2c(C)cc(=O)oc2c1
| Anwendung: | Fluorogenic HDAC substrate |
| CAS | 233691-67-3 |
| MW: | 445.51 D |
79,00 €
Boc-Lys(Ac)-AMC
Artikelnummer: Cay29682-10
Boc-Lys(Ac)-AMC is a fluorescent substrate for histone deacetylases (HDACs). Following deacetylation by an HDAC, Boc-Lys-AMC is cleaved by trypsin and 7-amino-4-methylcoumarin (AMC) is released and its fluorescence can be used to quantify HDAC activity. AMC displays excitation/emission maxima of 340-360/440-460 nm,...
| Schlagworte: | N-[(1S)-5-(acetylamino)-1-[[(4-methyl-2-oxo-2H-1-benzopyran-7-yl)amino]carbonyl]pentyl]-carbamic acid, 1,1-dimethylethyl... |
| Anwendung: | Fluorogenic HDAC substrate |
| CAS | 233691-67-3 |
| MW: | 445.5 D |
ab 77,00 €
