Zu "22978-25-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
GW 9662
Artikelnummer: Cay70785-10
The peroxisome proliferator-activated receptor gamma (PPARgamma) is the nuclear receptor responsible for transducing the therapeutic activity of the thiazolidinediones. Thiazolidinediones are a group of structurally related synthetic PPARgamma agonists with antidiabetic actions in vivo. Rosiglitazone (BRL 49653) is...
| Schlagworte: | 2-chloro-5-nitrobenzanilide |
| Anwendung: | Irreversible PPARgamma antagonist |
| CAS | 22978-25-2 |
| MW: | 276.7 D |
ab 16,00 €
GW9662
Artikelnummer: TGM-T2260-10mg
Description: GW9662 (TIMTEC-BB SBB006523) is a specific PPARgamma antagonist (IC50: 3.3 nM, in a cell-free assay), with 100 to 1000-fold functional selectivity for PPARgamma than PPARalpha/delta in cells. Target: PPAR. Smiles: [O-][N+](=O)c1ccc(Cl)c(c1)C(=O)Nc1ccccc1. References: Leesnitzer LM, et al. Biochemistry,...
| Schlagworte: | GW 9662, TIMTEC-BB SBB006523 |
| Anwendung: | Irreversible PPARgamma antagonist |
| CAS | 22978-25-2 |
| MW: | 276.68 D |
ab 46,00 €
