Zu "2280037-51-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Bobcat339
Artikelnummer: TGM-T5198-100mg
Description: Bobcat339 is a novel cytosine-based TET enzyme inhibitor (IC50s: 33/73 uM for TET1/2), but not DNMT3a, does not inhibit the DNA methyltransferase DNMT3a. Target: DNA Methyltransferase. Smiles: Nc1nc(=O)n(cc1Cl)-c1cccc(c1)-c1ccccc1. References: Chua GNL, et al. Cytosine-Based TET Enzyme Inhibitors. ACS...
| Schlagworte: | Bobcat339 hydrochloride, Bobcat339 hydrochloride |
| Anwendung: | TET1 / TET2 inhibitor |
| CAS | 2280037-51-4 |
| MW: | 297.74 D |
ab 46,00 €
Bobcat 339
Artikelnummer: Cay31453-5
Bobcat 339 is a cytosine derivative that was originally found to be an inhibitor of ten-eleven translocation methylcytosine dioxygenase 1 (TET1) and TET2 (IC50s = 33 and 73 µM, respectively, in cell-free assays). However, it was found that the TET inhibitory activity was due to residual copper in the Bobcat 339...
| Schlagworte: | 4-amino-1-[1,1'-biphenyl]-3-yl-5-chloro-2(1H)-pyrimidinone |
| Anwendung: | TET1 / TET2 inhibitor |
| CAS | 2280037-51-4 |
| MW: | 297.7 D |
ab 85,00 €
