Zu "2259624-71-8" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
STING Agonist-12
Artikelnummer: LKT-S771339.1
STING Agonist-12 is an activator of STING. SMILES: CC1(C2=C(C=C(C=C2)C(=O)NCC3=C(C=C(C=C3F)F)F)N(C1=O)CC4=C(C=CC=C4Cl)F)C
| Schlagworte: | Compound 53, STING Agonist C53, GTPL11960,... |
| Anwendung: | STING activator |
| CAS | 2259624-71-8 |
| MW: | 490.88 D |
ab 99,00 €
STING activator Compound 53
Artikelnummer: TGM-T9853-100mg
Description: STING activator Compound 53 based on an oxindole core structure demonstrated robust on-target functional activation of STING (human EC50 185 nM) in immortalised and primary cells and a cytokine induction fingerprint consistent with STING activation. Target: STING. Smiles:...
| Anwendung: | STING agonist |
| CAS | 2259624-71-8 |
| MW: | 490.88 D |
ab 34,00 €
C53
Artikelnummer: Cay37354-1
C53 is a STING agonist. It activates human wild-type STING (EC50 = 185 nM), as well as STING containing the polymorphisms R232, H232, or HAQ in HEK293 cells in an interferon-stimulated gene 54 (ISG54) luciferase reporter assay when used at a concentration of 10 µM. C53 (10 µM) induces the expression of IFN-alpha,...
| Schlagworte: | STING Agonist-12,... |
| Anwendung: | STING agonist |
| CAS | 2259624-71-8 |
| MW: | 490.9 D |
ab 36,00 €
