Zu "2259-96-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Cyclothiazide
Artikelnummer: TGM-T4573-100mg
Description: Cyclothiazide is a benzothiadiazide that acts as a potentiator of AMPA receptorsthat potently inhibits AMPA receptor desensitization, positively modulating its response to glutamic acid (EC50 = 3.8 M). Target: GluR. Smiles: NS(=O)(=O)c1cc2c(NC(NS2(=O)=O)C2CC3CC2C=C3)cc1Cl. References: Kessler et al...
| Anwendung: | Antihypertensive, Diuretic |
| CAS | 2259-96-3 |
| MW: | 389.88 D |
ab 48,00 €
Cyclothiazide
Artikelnummer: Cay16335-25
Receptors for AMPA are ionotropic glutamate receptors with critical roles in neurological development and function. Cyclothiazide is a benzothiadiazide that acts as a potentiator of AMPA receptors, positively modulating its response to glutamic acid (EC50 = 3.8 µM). It blocks the rapid agonist-induced...
| Schlagworte: | Doburil, 1,1-dioxide 3-bicyclo[2.2.1]hept-5-en-2-yl-6-chloro-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide |
| Anwendung: | AMPA receptor potentiator |
| CAS | 2259-96-3 |
| MW: | 389.9 D |
ab 61,00 €
